Chemical Properties
| Melting point | 251～252℃ |
| Boiling point | 581.1±50.0 °C(Predicted) |
| Density | 1.48±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Dichloromethane (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Off-White to Pale Beige |
| Major Application | food and beverages |
| InChIKey | SWOVVKGLGOOUKI-PBIZPCRONA-N |
| SMILES | C[C@]12CCC3C(=O)OCC=3[C@]1([H])C[C@@H]1O[C@]31C([C@@]1(C(C)C)O[C@H]1[C@@H]1O[C@]231)=O |&1:1,10,13,15,17,22,23,25,r| |
Safety Information
| WGK Germany | WGK 3 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 1 Oral Repr. 2 |
