Damascenone
- Product NameDamascenone
- CAS23696-85-7
- MFC13H18O
- MW190.28
- EINECS245-833-2
- MOL File23696-85-7.mol
Chemical Properties
| Boiling point | 275.6±10.0 °C(Predicted) |
| Density | 0.800-0.830 g/mL at 25 °C (lit.) |
| refractive index | 1.350-1.380 |
| FEMA | 3420 | 1-(2,6,6-TRIMETHYLCYCLOHEXA-1,3-DIENYL)-2-BUTEN-1-ONE |
| Flash point | 62°F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | liquid |
| color | yellow |
| Odor | at 10.00 % in dipropylene glycol. natural sweet fruity rose plum grape raspberry sugar |
| Odor Type | floral |
| JECFA Number | 387 |
| Stability | Light Sensitive |
| Major Application | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| Cosmetics Ingredients Functions | PERFUMING FRAGRANCE |
| InChI | 1S/C13H18O/c1-5-7-11(14)12-10(2)8-6-9-13(12,3)4/h5-8H,9H2,1-4H3/b7-5+ |
| InChIKey | POIARNZEYGURDG-FNORWQNLSA-N |
| SMILES | C\C=C\C(=O)C1=C(C)C=CCC1(C)C |
Safety Information
| Hazard Codes | F,Xi |
| Risk Statements | 11-43 |
| Safety Statements | 7-16-36/37 |
| RIDADR | UN 1170 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 33021090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 2 Skin Sens. 1 |