3-Bromopentane
- Product Name3-Bromopentane
- CAS1809-10-5
- MFC5H11Br
- MW151.04
- EINECS217-314-0
- MOL File1809-10-5.mol
Chemical Properties
| Melting point | -126.2°C |
| Boiling point | 118-119 °C (lit.) |
| Density | 1.216 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 65 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Miscible with ethanol, ether, benzene and chloroform. |
| form | Liquid |
| color | Clear pale yellow |
| BRN | 1730967 |
| Dielectric constant | 8.3699999999999992 |
| InChI | InChI=1S/C5H11Br/c1-3-5(6)4-2/h5H,3-4H2,1-2H3 |
| InChIKey | VTOQFOCYBTVOJZ-UHFFFAOYSA-N |
| SMILES | CCC(Br)CC |
| CAS DataBase Reference | 1809-10-5(CAS DataBase Reference) |
| EPA Substance Registry System | Pentane, 3-bromo- (1809-10-5) |
Safety Information
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| F | 19 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29033990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
