N-(1-Cyclohexen-1-yl)morpholine
- Product NameN-(1-Cyclohexen-1-yl)morpholine
- CAS670-80-4
- MFC10H17NO
- MW167.25
- EINECS211-579-6
- MOL File670-80-4.mol
Chemical Properties
| Boiling point | 118-120 °C10 mm Hg(lit.) |
| Density | 0.995 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 155 °F |
| storage temp. | 2-8°C |
| pka | 6.33±0.20(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| BRN | 118696 |
| InChI | InChI=1S/C10H17NO/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h4H,1-3,5-9H2 |
| InChIKey | IIQFBBQJYPGOHJ-UHFFFAOYSA-N |
| SMILES | N1(C2CCCCC=2)CCOCC1 |
| CAS DataBase Reference | 670-80-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Morpholine, 4-(1-cyclohexen-1-yl)-(670-80-4) |
| EPA Substance Registry System | Morpholine, 4-(1-cyclohexen-1-yl)- (670-80-4) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 9 |
| TSCA | TSCA listed |
| HS Code | 29349990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |