2-Hydroxy-4-methylpyridine
- Product Name2-Hydroxy-4-methylpyridine
- CAS13466-41-6
- MFC6H7NO
- MW109.13
- EINECS627-289-1
- MOL File13466-41-6.mol
Chemical Properties
| Melting point | 131-134 °C (lit.) |
| Boiling point | 186-187 °C/12 mmHg (lit.) |
| Density | 1.1143 (rough estimate) |
| refractive index | 1.5444 (estimate) |
| Flash point | 186-187°C/12mm |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | pK1:4.529(+1) (25°C) |
| color | White to Gray to Brown |
| BRN | 107082 |
| InChI | InChI=1S/C6H7NO/c1-5-2-3-7-6(8)4-5/h2-4H,1H3,(H,7,8) |
| InChIKey | YBDRFJXGJQULGH-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=CC(C)=C1 |
| CAS DataBase Reference | 13466-41-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-40 |
| Safety Statements | 26-37/39-36-22 |
| WGK Germany | 3 |
| HS Code | 29333995 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |