1H,1H,2H,2H-Perfluorohexyl iodide
- Product Name1H,1H,2H,2H-Perfluorohexyl iodide
- CAS2043-55-2
- MFC6H4F9I
- MW373.99
- EINECS218-055-6
- MOL File2043-55-2.mol
Chemical Properties
| Melting point | -25°C |
| Boiling point | 138 °C |
| Density | 1.94 g/mL at 20 °C (lit.) |
| refractive index | n |
| Flash point | 138-140°C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Soluble), Methanol (Slightly) |
| form | clear liquid |
| color | Colorless to Light yellow to Light red |
| Specific Gravity | 1.940 |
| Sensitive | Light Sensitive |
| BRN | 1870862 |
| Henry's Law Constant | 8.8×10-7 mol/(m3Pa) at 25℃, Zhang et al. (2010) |
| InChI | 1S/C6H4F9I/c7-3(8,1-2-16)4(9,10)5(11,12)6(13,14)15/h1-2H2 |
| InChIKey | CXHFIVFPHDGZIS-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCI |
| CAS DataBase Reference | 2043-55-2(CAS DataBase Reference) |
| EPA Substance Registry System | Hexane, 1,1,1,2,2,3,3,4,4-nonafluoro-6-iodo- (2043-55-2) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| F | 8 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29037800 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
