Triethylsulfonium bis(trifluoromethylsulfonyl)imide
- Product NameTriethylsulfonium bis(trifluoromethylsulfonyl)imide
- CAS321746-49-0
- MFC8H15F6NO4S3
- MW399.39
- EINECS
- MOL File321746-49-0.mol
Chemical Properties
| Melting point | -35.5°C |
| Density | 1.47 |
| refractive index | 1.4260 to 1.4300 |
| Water Solubility | Insoluble in water |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| InChI | 1S/C6H15S.C2F6NO4S2/c1-4-7(5-2)6-3;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4-6H2,1-3H3;/q+1;-1 |
| InChIKey | BLODSRKENWXTLO-UHFFFAOYSA-N |
| SMILES | CC[S+](CC)CC.FC(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F |
| CAS DataBase Reference | 321746-49-0 |
| ECW | 4.5 V |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29350090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 3 Eye Dam. 1 |
