2,6-Dichloro-4-nitrophenol
- Product Name2,6-Dichloro-4-nitrophenol
- CAS618-80-4
- MFC6H3Cl2NO3
- MW208
- EINECS210-563-6
- MOL File618-80-4.mol
Chemical Properties
| Melting point | 123-126 °C (dec.) |
| Boiling point | 285.2±40.0 °C(Predicted) |
| Density | 1.8220 |
| refractive index | 1.5650 (estimate) |
| storage temp. | Storage temp. 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.81±0.44(Predicted) |
| color | Light orange to Yellow to Green |
| BRN | 1245045 |
| InChI | 1S/C6H3Cl2NO3/c7-4-1-3(9(11)12)2-5(8)6(4)10/h1-2,10H |
| InChIKey | PXSGFTWBZNPNIC-UHFFFAOYSA-N |
| SMILES | Oc1c(Cl)cc(cc1Cl)[N+]([O-])=O |
| CAS DataBase Reference | 618-80-4(CAS DataBase Reference) |
| EPA Substance Registry System | Phenol, 2,6-dichloro-4-nitro- (618-80-4) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-36/37/39 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29089990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |
