4'-Butyl-4-biphenylcarbonitrile
- Product Name4'-Butyl-4-biphenylcarbonitrile
- CAS52709-83-8
- MFC17H17N
- MW235.32
- EINECS258-119-0
- MOL File52709-83-8.mol
Chemical Properties
| Melting point | 49-51°C |
| Boiling point | 210-212°C 2mm |
| Density | 1.04±0.1 g/cm3(Predicted) |
| Flash point | 210-212°C/2mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C17H17N/c1-2-3-4-14-5-9-16(10-6-14)17-11-7-15(13-18)8-12-17/h5-12H,2-4H2,1H3 |
| InChIKey | PJPLBHHDTUICNN-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(CCCC)C=C2)=CC=C(C#N)C=C1 |
| CAS DataBase Reference | 52709-83-8(CAS DataBase Reference) |
| NIST Chemistry Reference | [1,1'-Biphenyl]-4-carbonitrile, 4'-butyl-(52709-83-8) |
| EPA Substance Registry System | [1,1'-Biphenyl]-4-carbonitrile, 4'-butyl- (52709-83-8) |
Safety Information
| Risk Statements | 20/21/22-36/37/38-65-20/21 |
| Safety Statements | 26-36/37/39-60-36/37-9 |
| RIDADR | 3276 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
