2-(3-Chlorophenoxy)-propionic acid
한글명:2-(3-Chlorophenoxy)-propionic acid
카스 번호101-10-0
상품명:2-(3-Chlorophenoxy)-propionic acid
CBNumberCB9433498
분자식C9H9ClO3
포뮬러 무게200.62
MOL 파일101-10-0.mol
화학적 성질
녹는점 | 113-115 °C (lit.) |
끓는 점 | 288.02°C (rough estimate) |
밀도 | 1.2799 (rough estimate) |
굴절률 | 1.5230 (estimate) |
저장 조건 | Sealed in dry,2-8°C |
물리적 상태 | powder to crystal |
산도 계수 (pKa) | 3.13±0.10(Predicted) |
색상 | White to Light yellow to Light orange |
BRN | 1876444 |
InChI | InChI=1S/C9H9ClO3/c1-6(9(11)12)13-8-4-2-3-7(10)5-8/h2-6H,1H3,(H,11,12) |
InChIKey | YNTJKQDWYXUTLZ-UHFFFAOYSA-N |
SMILES | C(O)(=O)C(OC1=CC=CC(Cl)=C1)C |
CAS 데이터베이스 | 101-10-0(CAS DataBase Reference) |
EPA | Cloprop (101-10-0) |
위험품 표기 | Xi | |||||||||
위험 카페고리 넘버 | 36/37/38 | |||||||||
안전지침서 | 26-36 | |||||||||
WGK 독일 | 2 | |||||||||
RTECS 번호 | UE9285000 | |||||||||
HS 번호 | 29163990 | |||||||||
유해 물질 데이터 | 101-10-0(Hazardous Substances Data) | |||||||||
독성 | LD50 oral in rat: > 750mg/kg | |||||||||
NFPA 704: |
|