| Boiling point |
557.8±60.0 °C(Predicted) |
| Density |
1.33±0.1 g/cm3(Predicted) |
| vapor pressure |
0Pa at 25℃ |
| form |
powder to crystal |
| pka |
5.35±0.40(Predicted) |
| color |
Orange to Brown to Dark red |
| Appearance |
Orange to Brown to Dark Red Powder to Crystal |
| Water Solubility |
11-35970μg/L at 20-25℃ |
| InChI |
InChI=1S/C23H19N5O/c1-3-27(4-2)15-10-9-14-11-16-21(29-20(14)12-15)17(13-24)22(25)28-19-8-6-5-7-18(19)26-23(16)28/h5-12,25H,3-4H2,1-2H3 |
| InChIKey |
FXFIDVQMNRVEGQ-UHFFFAOYSA-N |
| SMILES |
C12C3=CC4=CC=C(N(CC)CC)C=C4OC3=C(C#N)C(=N)N1C1=CC=CC=C1N=2 |
| LogP |
3.63-5.5 at 25℃ |
| CAS DataBase Reference |
52372-39-1(CAS DataBase Reference) |
| EPA Substance Registry System |
7H-[1]Benzopyrano[3',2':3,4]pyrido[1,2-a]benzimidazole-6-carbonitrile, 3-(diethylamino)-7-imino- (52372-39-1) |
