4,4'-Ethylenedianiline
- Product Name4,4'-Ethylenedianiline
- CAS621-95-4
- CBNumberCB9709726
- MFC14H16N2
- MW212.29
- EINECS210-716-7
- MDL NumberMFCD00007923
- MOL File621-95-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 133-137 °C(lit.) |
| Boiling point | 342.14°C (rough estimate) |
| Density | 0.9678 (rough estimate) |
| vapor pressure | 0.001Pa at 20℃ |
| refractive index | 1.4400 (estimate) |
| storage temp. | room temp |
| pka | 5.17±0.10(Predicted) |
| form | Powder |
| color | White to Gray to Brown |
| BRN | 394999 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C14H16N2/c15-13-7-3-11(4-8-13)1-2-12-5-9-14(16)10-6-12/h3-10H,1-2,15-16H2 |
| InChIKey | UHNUHZHQLCGZDA-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(N)C=C1)CC1=CC=C(N)C=C1 |
| LogP | 2.25 at 23℃ and pH7.7-8.6 |
| CAS DataBase Reference | 621-95-4(CAS DataBase Reference) |
| EWG's Food Scores | 1 |
| NIST Chemistry Reference | Benzenamine, 4,4'-(1,2-ethanediyl)bis-(621-95-4) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi,Xn | |||||||||
| Risk Statements | 36/37/38-20/21/22 | |||||||||
| Safety Statements | 26-36/37 | |||||||||
| WGK Germany | 2 | |||||||||
| RTECS | BY0200000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2921.59.8090 | |||||||||
| HazardClass | IRRITANT | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
