Disodium 2,2'-dihydroxy-4,4'-dimethoxy-5,5'-disulfobenzophenone
- Product NameDisodium 2,2'-dihydroxy-4,4'-dimethoxy-5,5'-disulfobenzophenone
- CAS76656-36-5
- CBNumberCB9477771
- MFC15H12Na2O11S2
- MW478.36
- EINECS278-520-4
- MDL NumberMFCD02683831
- MOL File76656-36-5.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 350°C (dec.) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Water (Slightly) |
| color | Pale Yellow to Yellow |
| BRN | 9829705 |
| Stability | Hygroscopic |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| Cosmetics Ingredients Functions | UV ABSORBER |
| Cosmetic Ingredient Review (CIR) | Disodium 2,2'-dihydroxy-4,4'-dimethoxy-5,5'-disulfobenzophenone (76656-36-5) |
| InChI | 1S/C15H14O11S2.2Na/c1-25-11-5-9(16)7(3-13(11)27(19,20)21)15(18)8-4-14(28(22,23)24)12(26-2)6-10(8)17;;/h3-6,16-17H,1-2H3,(H,19,20,21)(H,22,23,24);;/q;2*+1/p-2 |
| InChIKey | QDCHWIWENYCPIL-UHFFFAOYSA-L |
| SMILES | O=C(C1=C(O)C=C(OC)C(S([O-])(=O)=O)=C1)C2=C(O)C=C(OC)C(S([O-])(=O)=O)=C2.[Na+].[Na+] |
| CAS DataBase Reference | 76656-36-5(CAS DataBase Reference) |
| EWG's Food Scores | 2 |
| FDA UNII | 7925W14T4L |
| EPA Substance Registry System | Benzenesulfonic acid, 3,3'-carbonylbis[4-hydroxy-6-methoxy-, disodium salt (76656-36-5) |
| UNSPSC Code | 77101502 |
| NACRES | NA.24 |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| HS Code | 2914500090 |
| Storage Class | 11 - Combustible Solids |
