Sodium cloxacillin monohydrate
- Product NameSodium cloxacillin monohydrate
- CAS7081-44-9
- CBNumberCB8705413
- MFC19H19ClN3NaO6S
- MW475.88
- EINECS629-588-2
- MDL NumberMFCD00150735
- MOL File7081-44-9.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 170℃ |
| Boiling point | 689℃ |
| Flash point | >110°(230°F) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | H2O: soluble50mg/mL |
| form | solid |
| color | White to Orange to Green |
| Water Solubility | Soluble in water |
| Merck | 13,2444 |
| BRN | 5403885 |
| Major Application | clinical testing |
| InChIKey | MUYUWQFVGNJMPH-UHFFFAOYSA-M |
| SMILES | [Na+].N12C(C(NC(C3=C(C)OCN3C3=CC=CC=C3Cl)=O)C1=O)SC(C)(C)C2C([O-])=O.[H]O[H] |
| CAS DataBase Reference | 7081-44-9(CAS DataBase Reference) |
| FDA UNII | 65LCB00B4Y |
| UNSPSC Code | 41116107 |
| NACRES | NA.24 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H315-H317-H319-H334-H335 | |||||||||
| Precautionary statements | P261-P280-P284-P304+P340-P305+P351+P338-P342+P311 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 36/37/38-42/43 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 2 | |||||||||
| RTECS | XH8920000 | |||||||||
| HS Code | 29411099 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 | |||||||||
| NFPA 704: |
|
