3,4,5-Trifluorophenol
- Product Name3,4,5-Trifluorophenol
- CAS99627-05-1
- CBNumberCB8699671
- MFC6H3F3O
- MW148.08
- EINECS436-120-9
- MDL NumberMFCD00042427
- MOL File99627-05-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 52-55 °C |
| Boiling point | 177°C |
| Density | 1.629 g/cm3 (20℃) |
| vapor pressure | 1.7hPa at 25℃ |
| Flash point | 177°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | 104g/l OECD Test Guideline 105 |
| form | Crystals or Low Melting Solid |
| pka | 8.00±0.23(Predicted) |
| color | Colorless to pale yellow |
| Water Solubility | 104g/L at 20℃ |
| BRN | 8830884 |
| InChI | InChI=1S/C6H3F3O/c7-4-1-3(10)2-5(8)6(4)9/h1-2,10H |
| InChIKey | ZRTWIJKGTUGZJY-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(F)=C(F)C(F)=C1 |
| LogP | 1.9 at 20℃ |
| CAS DataBase Reference | 99627-05-1(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H312+H332-H314-H411 | |||||||||
| Precautionary statements | P260-P273-P280-P301+P310+P330-P303+P361+P353-P305+P351+P338+P310 | |||||||||
| Hazard Codes | C,N,Xi,T | |||||||||
| Risk Statements | 22-34-51/53-36/37/38-25 | |||||||||
| Safety Statements | 26-36/37/39-45-60-36-61 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 2 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29081000 | |||||||||
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Aquatic Chronic 2 Eye Dam. 1 Skin Corr. 1B | |||||||||
| NFPA 704: |
|
