CDAP
- Product NameCDAP
- CAS59016-56-7
- CBNumberCB8452526
- MFC8H10BF4N3
- MW234.99
- MDL NumberMFCD00011998
- MOL File59016-56-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 196-200°C |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | Powder |
| color | White to yellow |
| biological source | synthetic |
| Water Solubility | Soluble in water, and acetonitrile. |
| λmax | 301nm(CH3CN)(lit.) |
| BRN | 5685616 |
| InChI | InChI=1S/C8H10N3.BF4/c1-10(2)8-3-5-11(7-9)6-4-8;2-1(3,4)5/h3-6H,1-2H3;/q+1;-1 |
| InChIKey | MBLVMDCQDCVKNE-UHFFFAOYSA-N |
| SMILES | [B+3]([F-])([F-])([F-])[F-].N(C1=CC=[N+](C#N)C=C1)(C)C |
| FDA UNII | P4W72066JT |
| UNSPSC Code | 12352200 |
| NACRES | NA.32 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi,Xn | |||||||||
| Risk Statements | 36/37/38-22 | |||||||||
| Safety Statements | 26-36-60-36/37-9 | |||||||||
| RIDADR | 1759 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 3-8-10-21 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29333990 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 | |||||||||
| NFPA 704: |
|
