2,3,5-Trichloropyridine
- Product Name2,3,5-Trichloropyridine
- CAS16063-70-0
- CBNumberCB8111540
- MFC5H2Cl3N
- MW182.44
- EINECS407-270-2
- MDL NumberMFCD00043007
- MOL File16063-70-0.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 46-50 °C (lit.) |
| Boiling point | 219 °C (lit.) |
| Density | 1.539±0.06 g/cm3(Predicted) |
| Flash point | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -2.92±0.10(Predicted) |
| form | Solid |
| color | Off-white to pale yellow |
| Water Solubility | Slightly soluble in water. |
| BRN | 119384 |
| InChI | InChI=1S/C5H2Cl3N/c6-3-1-4(7)5(8)9-2-3/h1-2H |
| InChIKey | CNLIIAKAAMFCJG-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(Cl)C=C1Cl |
| CAS DataBase Reference | 16063-70-0(CAS DataBase Reference) |
| EWG's Food Scores | 1 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H317-H318-H412 | |||||||||
| Precautionary statements | P261-P273-P280-P301+P310-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 52/53-36/37/38 | |||||||||
| Safety Statements | 61-37/39-26 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 2 | |||||||||
| RTECS | UU0525000 | |||||||||
| Hazard Note | Irritant | |||||||||
| HS Code | 29333990 | |||||||||
| Toxicity | mouse,LD50,intraperitoneal,430mg/kg (430mg/kg),BEHAVIORAL: SOMNOLENCE (GENERAL DEPRESSED ACTIVITY)LIVER: FATTY LIVER DEGERATIONBEHAVIORAL: ANTIPSYCHOTIC,Toxicology and Applied Pharmacology. Vol. 11, Pg. 361, 1967. | |||||||||
| NFPA 704: |
|
