alpha-Naphthyl phosphate disodium salt
- Product Namealpha-Naphthyl phosphate disodium salt
- CAS2183-17-7
- CBNumberCB7720907
- MFC10H10NaO4P
- MW248.15
- EINECS218-564-3
- MDL NumberMFCD00041007
- MOL File2183-17-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | >300°C |
| storage temp. | -20°C |
| solubility | water: 50 mg/mL, clear, colorless to very faintly yellow |
| form | powder |
| Water Solubility | water: 50mg/mL, clear, colorless to very faintly yellow |
| BRN | 4895811 |
| InChI | 1S/C10H9O4P.2Na/c11-15(12,13)14-10-7-3-5-8-4-1-2-6-9(8)10;;/h1-7H,(H2,11,12,13);;/q;2*+1/p-2 |
| InChIKey | QYURIFWAOPAPAJ-UHFFFAOYSA-L |
| SMILES | [Na+].[Na+].[O-]P([O-])(=O)Oc1cccc2ccccc12 |
| CAS DataBase Reference | 2183-17-7(CAS DataBase Reference) |
| UNSPSC Code | 12352204 |
| NACRES | NA.32 |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |