2-Chloro-3-cyano-4,6-dimethylpyridine
- Product Name2-Chloro-3-cyano-4,6-dimethylpyridine
- CAS14237-71-9
- CBNumberCB7713273
- MFC8H7ClN2
- MW166.61
- MDL NumberMFCD00051676
- MOL File14237-71-9.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 98-99°C |
| Boiling point | 305.3±37.0 °C(Predicted) |
| Density | 1.22±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | -0.41±0.10(Predicted) |
| color | White to Almost white |
| BRN | 131348 |
| InChI | InChI=1S/C8H7ClN2/c1-5-3-6(2)11-8(9)7(5)4-10/h3H,1-2H3 |
| InChIKey | RETJKTAVEQPNMH-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(C)=CC(C)=C1C#N |
| CAS DataBase Reference | 14237-71-9(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H315-H318-H335 | |||||||||
| Precautionary statements | P261-P280-P301+P310-P305+P351+P338 | |||||||||
| Hazard Codes | Xi,T | |||||||||
| Risk Statements | 36/37/38-41-37/38-25 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | 3276 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29333990 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
