1,2-Bis(trimethylsilyloxy)ethane
- Product Name1,2-Bis(trimethylsilyloxy)ethane
- CAS7381-30-8
- CBNumberCB7452130
- MFC8H22O2Si2
- MW206.43
- EINECS230-950-3
- MDL NumberMFCD00009640
- MOL File7381-30-8.mol
- MSDS FileSDS
Chemical Properties
| Boiling point | 165-166 °C (lit.) |
| Density | 0.842 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 115 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| color | Clear colorless to faint yellow |
| Specific Gravity | 0.842 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| BRN | 1744217 |
| InChI | InChI=1S/C8H22O2Si2/c1-11(2,3)9-7-8-10-12(4,5)6/h7-8H2,1-6H3 |
| InChIKey | JGWFUSVYECJQDT-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OCCO[Si](C)(C)C |
| CAS DataBase Reference | 7381-30-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,2-Bis(trimethylsiloxy)ethane(7381-30-8) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H226 | |||||||||
| Precautionary statements | P210-P233-P240-P241+P242+P243-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P370+P378-P403+P235-P501-P241-P280a-P303+P361+P353-P501a | |||||||||
| Risk Statements | 10 | |||||||||
| Safety Statements | 23-24/25-16 | |||||||||
| RIDADR | UN 1993 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| TSCA | No | |||||||||
| HazardClass | 3.2 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29319090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Flam. Liq. 3 | |||||||||
| NFPA 704: |
|
