3,3'-Diaminobenzidine tetrahydrochloride hydrate
- Product Name3,3'-Diaminobenzidine tetrahydrochloride hydrate
- CAS868272-85-9
- CBNumberCB6874674
- MFC12H17ClN4O
- MW268.75
- EINECS685-525-9
- MDL NumberMFCD08273058
- MOL File868272-85-9.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 300°C |
| storage temp. | room temp |
| solubility | H2O: soluble50mg/mL |
| form | Powder |
| color | White to Amber to Dark purple |
| Water Solubility | Soluble at 5%(w/v) in water |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C12H14N4.ClH.H2O/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8;;/h1-6H,13-16H2;1H;1H2 |
| InChIKey | YOEDEMAWKGDBAW-UHFFFAOYSA-N |
| SMILES | NC1=C(C=CC(C2C=CC(N)=C(N)C=2)=C1)N.Cl.O |
| FDA UNII | Z3KH58591V |
| UNSPSC Code | 41116105 |
| NACRES | NA.47 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H341-H350 | |||||||||
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 | |||||||||
| Hazard Codes | Xn,T | |||||||||
| Risk Statements | 45-68-36-22 | |||||||||
| Safety Statements | 22-24/25-45-53-26 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | DV8753000 | |||||||||
| TSCA | Yes | |||||||||
| HS Code | 29215900 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Carc. 1B Eye Irrit. 2 Muta. 2 | |||||||||
| NFPA 704: |
|
