2,5-Difluoroaniline
- Product Name2,5-Difluoroaniline
- CAS367-30-6
- CBNumberCB6299323
- MFC6H5F2N
- MW129.11
- EINECS206-690-1
- MDL NumberMFCD00007651
- MOL File367-30-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 11-13 °C (lit.) |
| Boiling point | 176-178 °C (lit.) |
| Density | 1.288 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 156 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| pka | 2.19±0.10(Predicted) |
| color | Colorless to Yellow to Orange |
| Specific Gravity | 1.29 |
| Water Solubility | Not miscible in water. |
| BRN | 2802549 |
| InChI | InChI=1S/C6H5F2N/c7-4-1-2-5(8)6(9)3-4/h1-3H,9H2 |
| InChIKey | YNOOQIUSYGWMSS-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(F)=CC=C1F |
| CAS DataBase Reference | 367-30-6(CAS DataBase Reference) |
| FDA UNII | 4JNJ8ZZ368 |
| NIST Chemistry Reference | Benzenamine, 2,5-difluoro-(367-30-6) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H312+H332-H317 | |||||||||
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 | |||||||||
| Hazard Codes | Xn,Xi | |||||||||
| Risk Statements | 20/21/22-36/37/38 | |||||||||
| Safety Statements | 28-36/37/39-26-36 | |||||||||
| RIDADR | 2941 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 8-10-23 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29214210 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Skin Sens. 1 | |||||||||
| NFPA 704: |
|
