2-Bromo-4-chlorophenol
- Product Name2-Bromo-4-chlorophenol
- CAS695-96-5
- CBNumberCB6215851
- MFC6H4BrClO
- MW207.45
- EINECS211-785-6
- MDL NumberMFCD00002319
- MOL File695-96-5.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 31-33 °C (lit.) |
| Boiling point | 121-123 °C/10 mmHg (lit.) |
| Density | 1.6027 (rough estimate) |
| refractive index | 1.5730 (estimate) |
| Flash point | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | methanol: 0.1 g/mL, clear |
| form | powder to lump to clear liquid |
| pka | 7.98±0.18(Predicted) |
| color | White or Colorles to Yellow to Orange |
| BRN | 2042871 |
| InChI | InChI=1S/C6H4BrClO/c7-5-3-4(8)1-2-6(5)9/h1-3,9H |
| InChIKey | ZIYRDJLAJYTELF-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(Cl)C=C1Br |
| CAS DataBase Reference | 695-96-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 2-bromo-4-chloro-(695-96-5) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-28-36/39-24/25 | |||||||||
| RIDADR | UN 2020 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29081000 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
