Sodium prasterone sulfate
- Product NameSodium prasterone sulfate
- CAS1099-87-2
- CBNumberCB5690783
- MFC19H27NaO5S
- MW390.47
- EINECS214-152-2
- MDL NumberMFCD00010470
- MOL File1099-87-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 148-149 °C (dec.)(lit.) |
| refractive index | 10 ° (C=4, MeOH) |
| Flash point | 9℃ |
| storage temp. | -20°C |
| solubility | methanol: clear to hazy |
| form | powder |
| color | white to off-white |
| Merck | 14,2871 |
| InChIKey | GFJWACFSUSFUOG-QGVZUKINNA-M |
| SMILES | [C@]12([H])CC[C@]3(C)C(CC[C@@]3([H])[C@]1([H])CC=C1C[C@@H](OS([O-])(=O)=O)CC[C@]21C)=O.[Na+] |&1:0,4,9,11,17,25,r| |
| CAS DataBase Reference | 1099-87-2(CAS DataBase Reference) |
| FDA UNII | B9840IHU4T |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H225-H301+H311+H331-H370 | |||||||||
| Precautionary statements | P210-P260-P280-P301+P310-P311 | |||||||||
| Hazard Codes | F,C,T | |||||||||
| Risk Statements | 11-34-39/23/24/25-23/24/25 | |||||||||
| Safety Statements | 16-26-36/37/39-45-36/37-7 | |||||||||
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | BV8397400 | |||||||||
| Toxicity | dog,LD50,intravaginal,> 500mg/kg (500mg/kg),Gekkan Yakuji. Pharmaceuticals Monthly. Vol. 40, Pg. 444, 1998. | |||||||||
| NFPA 704: |
|
