1,1,2,2-Tetrahydroperfluoro dodecanol
- Product Name1,1,2,2-Tetrahydroperfluoro dodecanol
- CAS865-86-1
- CBNumberCB5309898
- MFC12H5F21O
- MW564.13
- EINECS212-748-7
- MDL NumberMFCD00039545
- MOL File865-86-1.mol
Chemical Properties
| Melting point | 95 °C |
| Boiling point | 145 °C |
| Density | 1.664±0.06 g/cm3(Predicted) |
| Flash point | 145°C/10mm |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly, Heated, Sonicated), Methanol (Slightly, Sonicated) |
| form | Solid |
| pka | 14.28±0.10(Predicted) |
| color | White to Off-White |
| Water Solubility | Insoluble in water. |
| BRN | 2029867 |
| Major Application | PFAS testing clinical testing coatings environmental food and beverages |
| InChIKey | FLXYIZWPNQYPIT-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCO |
| CAS DataBase Reference | 865-86-1(CAS DataBase Reference) |
| FDA UNII | A72U7Q973T |
| EPA Substance Registry System | 1-Dodecanol, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluoro- (865-86-1) |
| UNSPSC Code | 41116107 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H228-H315-H319-H335 | |||||||||
| Precautionary statements | P280-P210 | |||||||||
| Hazard Codes | F | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36-24/25 | |||||||||
| WGK Germany | WGK 3 | |||||||||
| Hazard Note | Flammable | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 29055900 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Lact. Repr. 1B STOT RE 1 | |||||||||
| NFPA 704: |
|
