KHELLIN
- Product NameKHELLIN
- CAS82-02-0
- CBNumberCB5269554
- MFC14H12O5
- MW260.24
- EINECS201-392-8
- MDL NumberMFCD00005007
- MOL File82-02-0.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 150154°C |
| Boiling point | 180200°C0.05mm Hg |
| Density | 1.1954 (rough estimate) |
| refractive index | 1.4560 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | crystalline |
| color | light yellow |
| Water Solubility | 247.2g/L(25 ºC) |
| Merck | 14,5309 |
| BRN | 263185 |
| Major Application | food and beverages |
| InChI | 1S/C14H12O5/c1-7-6-9(15)10-11(16-2)8-4-5-18-12(8)14(17-3)13(10)19-7/h4-6H,1-3H3 |
| InChIKey | HSMPDPBYAYSOBC-UHFFFAOYSA-N |
| SMILES | COc1c2OC(C)=CC(=O)c2c(OC)c3ccoc13 |
| LogP | 1.770 (est) |
| NCI Dictionary of Cancer Terms | keloid |
| FDA UNII | 5G117T0TJZ |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301+H311+H331-H315-H319-H335 | |||||||||
| Precautionary statements | P280-P301+P310+P330-P302+P352+P312-P304+P340+P311-P305+P351+P338 | |||||||||
| Hazard Codes | T | |||||||||
| Risk Statements | 25-38-36/37/38-23/24/25 | |||||||||
| Safety Statements | 36/37/39-45-26 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | LV1050000 | |||||||||
| HS Code | 2932.99.7000 | |||||||||
| HazardClass | 6.1(b) | |||||||||
| PackingGroup | III | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| Toxicity | LD50 in mice, rats (mg/kg): 30.6, 34.4 i.v.; 50.8, 68.8 orally (Busch) | |||||||||
| NFPA 704: |
|
