| Melting point |
204-206 °C(lit.) |
| Boiling point |
436.16°C (rough estimate) |
| alpha |
-115 º (c=1, EtOH) |
| Density |
1.0863 (rough estimate) |
| vapor pressure |
0Pa at 25℃ |
| refractive index |
-107.5 ° (C=1, EtOH) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
0.25g/l |
| form |
Crystalline Powder |
| pka |
5.80, 10.03(at 25℃) |
| color |
White to cream |
| PH |
9 (0.2g/l, H2O, 20℃) |
| optical activity |
[α]23/D 109.2°, c = 1.5 in ethanol |
| Water Solubility |
Insoluble |
| Sensitive |
Light Sensitive |
| Merck |
14,2286 |
| BRN |
89690 |
| Stability |
Stable, but light-sensitive. Incompatible with strong oxidizing agents. |
| InChI |
1S/C19H22N2O/c1-2-13-12-21-10-8-14(13)11-18(21)19(22)16-7-9-20-17-6-4-3-5-15(16)17/h2-7,9,13-14,18-19,22H,1,8,10-12H2/t13-,14-,18-,19+/m0/s1 |
| InChIKey |
KMPWYEUPVWOPIM-NAHPKXJFSA-N |
| SMILES |
O[C@@H]([C@@H]1C[C@@H]2CCN1C[C@@H]2C=C)c3ccnc4ccccc34 |
| LogP |
2.68 at 25℃ |
| CAS DataBase Reference |
485-71-2(CAS DataBase Reference) |
| EWG's Food Scores |
1 |
| FDA UNII |
1U622LRA8Z |
| NIST Chemistry Reference |
Cinchonidine(485-71-2) |
| EPA Substance Registry System |
Cinchonan-9-ol, (8.alpha.,9R)- (485-71-2) |
| UNSPSC Code |
12352005 |
| NACRES |
NA.22 |
