5-Amino-8-quinolinol dihydrochloride
- Product Name5-Amino-8-quinolinol dihydrochloride
- CAS21302-43-2
- CBNumberCB5224436
- MFC9H10Cl2N2O
- MW233.09
- MDL NumberMFCD00012737
- MOL File21302-43-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 279 °C (dec.)(lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| color | Orange to Amber to Dark red |
| Water Solubility | almost transparency |
| InChI | 1S/C9H8N2O.2ClH/c10-7-3-4-8(12)9-6(7)2-1-5-11-9;;/h1-5,12H,10H2;2*1H |
| InChIKey | VTQDJAUGGZFPOI-UHFFFAOYSA-N |
| SMILES | Cl[H].Cl[H].Nc1ccc(O)c2ncccc12 |
| CAS DataBase Reference | 21302-43-2(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| HS Code | 29334990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
