| Melting point |
266-269 °C (lit.) |
| Boiling point |
397.0±37.0 °C(Predicted) |
| Density |
1.178±0.06 g/cm3(Predicted) |
| storage temp. |
under inert gas (nitrogen or Argon) at 2-8°C |
| solubility |
almost transparency in Methanol |
| form |
powder to crystal |
| pka |
5.31±0.10(Predicted) |
| color |
White to Light yellow |
| Sensitive |
Hygroscopic |
| BRN |
160918 |
| InChI |
InChI=1S/C14H12N2/c1-9-10(2)12-6-4-8-16-14(12)13-11(9)5-3-7-15-13/h3-8H,1-2H3 |
| InChIKey |
BRPQDJPJBCQFSR-UHFFFAOYSA-N |
| SMILES |
N1C2C(=C(C)C(C)=C3C=2N=CC=C3)C=CC=1 |
| CAS DataBase Reference |
3002-81-1(CAS DataBase Reference) |
| NIST Chemistry Reference |
5,6-Dimethyl-1,10-phenanthroline(3002-81-1) |
| EPA Substance Registry System |
1,10-Phenanthroline, 5,6-dimethyl- (3002-81-1) |
| UNSPSC Code |
12352100 |
| NACRES |
NA.22 |