2,2,2-Trifluoroethyl trifluoromethanesulfonate
- Product Name2,2,2-Trifluoroethyl trifluoromethanesulfonate
- CAS6226-25-1
- CBNumberCB5142808
- MFC3H2F6O3S
- MW232.1
- EINECS458-390-7
- MDL NumberMFCD00671579
- MOL File6226-25-1.mol
- MSDS FileSDS
Chemical Properties
| Boiling point | 89-91°C |
| Density | 1,61 g/cm3 |
| refractive index | 1.3037 |
| RTECS | PB2775000 |
| Flash point | >110°(230°F) |
| storage temp. | 2-8°C |
| solubility | Chloroform, Methanol (Slightly) |
| form | Liquid |
| color | Colorless to yellow |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C3H2F6O3S/c4-2(5,6)1-12-13(10,11)3(7,8)9/h1H2 |
| InChIKey | RTMMSCJWQYWMNK-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)S(OCC(F)(F)F)(=O)=O |
| CAS DataBase Reference | 6226-25-1(CAS DataBase Reference) |
| EPA Substance Registry System | Methanesulfonic acid, trifluoro-, 2,2,2-trifluoroethyl ester (6226-25-1) |
| UNSPSC Code | 12352101 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H314-H330 | |||||||||
| Precautionary statements | P260-P270-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 | |||||||||
| Hazard Codes | Xi,T,C | |||||||||
| Risk Statements | 36/37/38-34-23/25 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | 3265 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | TOXIC, CORROSIVE | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | Ⅱ | |||||||||
| HS Code | 29055900 | |||||||||
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | |||||||||
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 3 Oral Skin Corr. 1B | |||||||||
| NFPA 704: |
|
