Disodium fumarate
- Product NameDisodium fumarate
- CAS17013-01-3
- CBNumberCB4463472
- MFC4H5NaO4
- MW140.07
- EINECS241-087-7
- MDL NumberMFCD00064567
- MOL File17013-01-3.mol
- MSDS FileSDS
Chemical Properties
| Melting point | >300°C |
| storage temp. | Store below +30°C. |
| solubility | 228g/l |
| form | Crystalline Powder |
| color | White |
| PH | 7-8 (50g/l, H2O) |
| Odor | Odorless |
| Water Solubility | 228 g/L |
| Sensitive | Hygroscopic |
| Hydrolytic Sensitivity | 0: forms stable aqueous solutions |
| BRN | 4301302 |
| Cosmetics Ingredients Functions | BUFFERING |
| Cosmetic Ingredient Review (CIR) | Disodium fumarate (17013-01-3) |
| InChI | InChI=1S/C4H4O4.Na.H/c5-3(6)1-2-4(7)8;;/h1-2H,(H,5,6)(H,7,8);;/b2-1+;; |
| InChIKey | GRGUKBNLSYVJML-SEPHDYHBSA-N |
| SMILES | C(/C(=O)O)=C\C(=O)O.[NaH] |
| LogP | -0.008 (est) |
| CAS DataBase Reference | 17013-01-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36-37/39 | |||||||||
| WGK Germany | 2 | |||||||||
| RTECS | LT1830000 | |||||||||
| F | 3 | |||||||||
| TSCA | No | |||||||||
| HS Code | 2917 19 80 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Toxicity | human,TDLo,oral,215mg/kg (215mg/kg),GASTROINTESTINAL: OTHER CHANGESGASTROINTESTINAL: "HYPERMOTILITY, DIARRHEA"GASTROINTESTINAL: NAUSEA OR VOMITING,Journal of the American Pharmaceutical Association, Scientific Edition. Vol. 31, Pg. 1, 1942. | |||||||||
| NFPA 704: |
|
