Endosulfan sulfate
- Product NameEndosulfan sulfate
- CAS1031-07-8
- CBNumberCB4457785
- MFC9H6Cl6O4S
- MW422.92
- EINECS623-765-8
- MDL NumberMFCD00151179
- MOL File1031-07-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 147.71°C |
| Boiling point | 480.7±45.0 °C(Predicted) |
| Density | 1.6835 (estimate) |
| vapor pressure | 9.75 x 10-6 mmHg at 25 °C (subcooled liquid vapor pressure calculated from GC retention time data,Hinckley et al., 1990) |
| Flash point | -26 °C |
| storage temp. | APPROX 4°C |
| solubility | DMSO: Slightly Soluble,Methanol: Slightly Soluble |
| form | Liquid |
| color | Clear colorless |
| Water Solubility | 117 ppb (Ali, 1978) |
| Henry's Law Constant | 4.64(x 10-5 atmm3/mol) at 25 °C (approximate - calculated from water solubility and vapor pressure) |
| Major Application | agriculture environmental |
| InChI | 1S/C9H6Cl6O4S/c10-5-6(11)8(13)4-2-19-20(16,17)18-1-3(4)7(5,12)9(8,14)15/h3-4H,1-2H2/t3,4,7-,8+ |
| InChIKey | AAPVQEMYVNZIOO-WINLOITPSA-N |
| SMILES | ClC1=C(Cl)[C@]2(Cl)C3COS(=O)(=O)OCC3[C@@]1(Cl)C2(Cl)Cl |
| EWG's Food Scores | 1 |
| FDA UNII | 8QTV9M19B2 |
| EPA Substance Registry System | Endosulfan sulfate (1031-07-8) |
Safety
| Symbol(GHS) |
![]()
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H300+H310+H330-H410 | |||||||||
| Precautionary statements | P260-P262-P273-P280-P302+P352+P310-P304+P340+P310 | |||||||||
| Hazard Codes | T+,N,Xn,F,T | |||||||||
| Risk Statements | 28-50/53-67-65-62-51/53-48/20-38-11-39/23/24/25-23/24/25 | |||||||||
| Safety Statements | 22-24/25-45-60-61-62-36/37-16-7-33-29-9 | |||||||||
| RIDADR | 2761 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | RB9150000 | |||||||||
| HazardClass | 6.1(a) | |||||||||
| PackingGroup | II | |||||||||
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | |||||||||
| Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Acute 1 Aquatic Chronic 1 | |||||||||
| Hazardous Substances Data | 1031-07-8(Hazardous Substances Data) | |||||||||
| NFPA 704: |
|
