5-Methyl-3-phenylisoxazole-4-carbonyl chloride
- Product Name5-Methyl-3-phenylisoxazole-4-carbonyl chloride
- CAS16883-16-2
- CBNumberCB4412218
- MFC11H8ClNO2
- MW221.64
- EINECS240-915-4
- MDL NumberMFCD00052205
- MOL File16883-16-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 24 °C |
| Boiling point | 115-117 °C(Press: 3 Torr) |
| Density | 1.27 |
| vapor pressure | 0.007Pa at 25℃ |
| Flash point | >100 |
| solubility | soluble in Methanol |
| form | powder to lump |
| pka | -4.78±0.50(Predicted) |
| color | White to Light yellow |
| Water Solubility | 701.8mg/L at 25℃ |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C11H8ClNO2/c1-7-9(11(12)14)10(13-15-7)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | HXEVQMXCHCDPSO-UHFFFAOYSA-N |
| SMILES | C(Cl)(C1=C(C)ON=C1C1=CC=CC=C1)=O |
| LogP | 1.97 at 25℃ |
| CAS DataBase Reference | 16883-16-2(CAS DataBase Reference) |
| FDA UNII | 97OT2T1W6V |
| EPA Substance Registry System | 4-Isoxazolecarbonyl chloride, 5-methyl-3-phenyl- (16883-16-2) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314-H318 | |||||||||
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a | |||||||||
| Hazard Codes | C,Xi | |||||||||
| Risk Statements | 22-34-36 | |||||||||
| Safety Statements | 26-36/37/39-45-26/36/37/39/45-20 | |||||||||
| RIDADR | UN3261 | |||||||||
| Hazard Note | Corrosive | |||||||||
| TSCA | Yes | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2934999090 | |||||||||
| NFPA 704: |
|
