2-Bromo-4,6-difluoroaniline
- Product Name2-Bromo-4,6-difluoroaniline
- CAS444-14-4
- CBNumberCB4391690
- MFC6H4BrF2N
- MW208
- EINECS429-430-0
- MDL NumberMFCD00009639
- MOL File444-14-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 41-42 °C (lit.) |
| Boiling point | 208.0±35.0 °C(Predicted) |
| Density | 1.6953 (rough estimate) |
| refractive index | 1.5320 (estimate) |
| Flash point | 177 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 1.20±0.10(Predicted) |
| form | powder to crystal |
| color | White to Green to Brown |
| Water Solubility | Insoluble in water. |
| BRN | 2718139 |
| InChI | InChI=1S/C6H4BrF2N/c7-4-1-3(8)2-5(9)6(4)10/h1-2H,10H2 |
| InChIKey | WUJKFVGKLTWVSQ-UHFFFAOYSA-N |
| SMILES | C1(N)=C(F)C=C(F)C=C1Br |
| CAS DataBase Reference | 444-14-4(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H312+H332-H315-H319-H335-H411 | |||||||||
| Precautionary statements | P273-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 | |||||||||
| Hazard Codes | Xn,Xi,N | |||||||||
| Risk Statements | 20/21/22-36/37/38-51/53-22 | |||||||||
| Safety Statements | 26-36-36/37/39-61-25 | |||||||||
| RIDADR | UN 1325 4.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | 9 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29214200 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
