Sodium 3,5-chloro-6-hydroxybenzenesulfonate
- Product NameSodium 3,5-chloro-6-hydroxybenzenesulfonate
- CAS54970-72-8
- CBNumberCB4197780
- MFC6H3Cl2NaO4S
- MW265.05
- EINECS259-416-8
- MDL NumberMFCD00009798
- MOL File54970-72-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | >300 °C |
| storage temp. | room temp |
| solubility | H2O: 50 mg/mL, clear, colorless |
| form | powder |
| color | White to Light yellow to Light orange |
| PH | 7 (53g/l, H2O, 20℃) |
| Water Solubility | H2O: 50mg/mL |
| Sensitive | Hygroscopic |
| BRN | 3640643 |
| InChI | InChI=1S/C6H4Cl2O4S.Na/c7-3-1-4(8)6(9)5(2-3)13(10,11)12;/h1-2,9H,(H,10,11,12);/q;+1/p-1 |
| InChIKey | NMWCVZCSJHJYFW-UHFFFAOYSA-M |
| SMILES | C1(S([O-])(=O)=O)C=C(C=C(Cl)C=1O)Cl.[Na+] |
| CAS DataBase Reference | 54970-72-8(CAS DataBase Reference) |
| UNSPSC Code | 12352107 |
| NACRES | NA.47 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/38-36/37/38 | |||||||||
| Safety Statements | 24/25-36-26 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 29089000 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
