9-BBN dimer
- Product Name9-BBN dimer
- CAS21205-91-4
- CBNumberCB4155805
- MFC16H30B2
- MW244.03
- EINECS629-228-4
- MDL NumberMFCD00168069
- MOL File21205-91-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 150-152 °C(lit.) |
| Boiling point | 365.8±48.0 °C(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in tetrahydrofuran, ether, hexane, benzene, toluene, carbon tetrachloride, chloroform, dichloromethane and dimethylsulfide. Slightly soluble in cyclohexane, dimethoxyethane, diglyme and dioxane. |
| form | crystalline |
| Sensitive | Air & Moisture Sensitive |
| BRN | 605509 |
| Stability | Hygroscopic, Moisture Sensitive |
| InChI | InChI=1S/C16H30B2/c1-5-13-7-2-8-14(6-1)17(13)19-18(20-17)15-9-3-10-16(18)12-4-11-15/h13-16H,1-12H2 |
| InChIKey | IYDIZBOKVLHCQZ-GEEKYZPCSA-N |
| SMILES | B12([H]B3(C4CCCC3CCC4)[H]1)C1CCCC2CCC1 |
| UNSPSC Code | 12352005 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
![]()
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H228-H261-H315-H319-H335 | |||||||||
| Precautionary statements | P210-P231+P232-P261-P305+P351+P338-P422 | |||||||||
| Hazard Codes | F,Xi | |||||||||
| Risk Statements | 11-14/15-36/37/38 | |||||||||
| Safety Statements | 26-43 | |||||||||
| RIDADR | UN 3396 4.3/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-16 | |||||||||
| HazardClass | 4.2 | |||||||||
| PackingGroup | I | |||||||||
| HS Code | 29349990 | |||||||||
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water | |||||||||
| Hazard Classifications | Eye Irrit. 2 Flam. Sol. 1 Skin Irrit. 2 STOT SE 3 Water-react 2 | |||||||||
| NFPA 704: |
|

