Methyl 2,6-dichloronicotinate
- Product NameMethyl 2,6-dichloronicotinate
- CAS65515-28-8
- CBNumberCB3500167
- MFC7H5Cl2NO2
- MW206.03
- MDL NumberMFCD07369794
- MOL File65515-28-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 56-60 °C(lit.) |
| Boiling point | 270.5±35.0 °C(Predicted) |
| Density | 1.426±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | -4.55±0.10(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| Sensitive | Air Sensitive |
| λmax | 276nm(lit.) |
| InChI | InChI=1S/C7H5Cl2NO2/c1-12-7(11)4-2-3-5(8)10-6(4)9/h2-3H,1H3 |
| InChIKey | IFVVGOJYWCHRCT-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=CC=C1C(OC)=O |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22-36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 2933399990 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
