Diphenyl ditelluride
- Product NameDiphenyl ditelluride
- CAS32294-60-3
- CBNumberCB3416709
- MFC12H10Te2
- MW409.41
- EINECS250-982-1
- MDL NumberMFCD00192106
- MOL File32294-60-3.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 65-67 °C (lit.) |
| storage temp. | Store at room temperature |
| Water Solubility | Insoluble in water |
| solubility | sol acetone, chloroform, tetrachloromethane; moderately sol ether; slightly sol ethanol. |
| form | solid |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C12H10Te2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12/h1-10H |
| InChIKey | VRLFOXMNTSYGMX-UHFFFAOYSA-N |
| SMILES | C1(C=CC=CC=1)[Te][Te]C1=CC=CC=C1 |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H312+H332-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 | |||||||||
| Hazard Codes | Xn,T,Xi | |||||||||
| Risk Statements | 20/21/22-36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| RIDADR | 3282 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 6.1(b) | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29310099 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
