9-Borabicyclo[3.3.1]nonane
- Product Name9-Borabicyclo[3.3.1]nonane
- CAS280-64-8
- CBNumberCB3416592
- MFC8H15B
- MW122.02
- EINECS206-000-9
- MDL NumberMFCD00074742
- MOL File280-64-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 140-142 °C |
| Boiling point | 68-70 °C |
| Density | 0.894 g/mL at 25 °C |
| Flash point | 1 °F |
| storage temp. | Flammables area |
| solubility | Miscible with ether, hexane, benzene, toluene, carbon tetrachloride, chloroform, dimethylsulfide and dichloromethane. Slightly miscible with cyclohexane, dimethoxyethane, diglyme and dioxane. |
| form | liquid |
| Water Solubility | reacts |
| Sensitive | Air & Moisture Sensitive |
| BRN | 605509 |
| Exposure limits | ACGIH: TWA 50 ppm; STEL 100 ppm (Skin) OSHA: TWA 200 ppm(590 mg/m3) NIOSH: IDLH 2000 ppm; TWA 200 ppm(590 mg/m3); STEL 250 ppm(735 mg/m3) |
| InChI | InChI=1S/C8H15B/c1-3-7-5-2-6-8(4-1)9-7/h7-9H,1-6H2 |
| InChIKey | FEJUGLKDZJDVFY-OCAPTIKFSA-N |
| SMILES | C12BC(CCC1)CCC2 |
| FDA UNII | 4K4J8L1OG9 |
| EPA Substance Registry System | 9-Borabicyclo[3.3.1]nonane (280-64-8) |
| UNSPSC Code | 12352005 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
![]() ![]() ![]()
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H261-H333-H225-H260-H302-H319-H335-H351-H304-H315-H336-H361f-H373-H411 | |||||||||
| Precautionary statements | P210-P231+P232-P280-P370+P378-P402+P404-P403+P235-P201-P273-P301+P310-P331-P223-P303+P361+P353-P305+P351+P338-P405-P501a | |||||||||
| Hazard Codes | F,Xn,Xi,N | |||||||||
| Risk Statements | 14-20/21/22-36/37/38-36/37-19-14/15-11-67-65-62-51/53-48/20-38-40 | |||||||||
| Safety Statements | 16-26-36/37/39-45-43-33-62-61-36/37-29-7/8-37/39 | |||||||||
| RIDADR | UN 3399 4.3/PG 1 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 1-10-34 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 4.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29319090 | |||||||||
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 Water-react 1 | |||||||||
| NFPA 704: |
|


