Chlorendic anhydride
- Product NameChlorendic anhydride
- CAS115-27-5
- CBNumberCB3264515
- MFC9H2Cl6O3
- MW370.83
- EINECS204-077-3
- MDL NumberMFCD00080438
- MOL File115-27-5.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 235-239 °C(lit.) |
| Boiling point | 486.58°C (rough estimate) |
| Density | 1,73 g/cm3 |
| vapor density | 13 (vs air) |
| vapor pressure | 0-0.003Pa at 20-24.85℃ |
| refractive index | 1.5550 (estimate) |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | insoluble |
| Sensitive | Moisture Sensitive |
| Merck | 14,2086 |
| BRN | 92693 |
| Henry's Law Constant | 1.1×102 mol/(m3Pa) at 25℃, Zhang et al. (2010) |
| InChI | 1S/C9H2Cl6O3/c10-3-4(11)8(13)2-1(5(16)18-6(2)17)7(3,12)9(8,14)15/h1-2H/t1,2,7-,8+ |
| InChIKey | FLBJFXNAEMSXGL-UHFFFAOYSA-N |
| SMILES | ClC1=C(Cl)[C@@]2(Cl)C3C(C(=O)OC3=O)[C@]1(Cl)C2(Cl)Cl |
| LogP | -1.59-1.39 at 20-25℃ |
| CAS DataBase Reference | 115-27-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335-H351-H373-H412 | |||||||||
| Precautionary statements | P201-P273-P302+P352-P305+P351+P338-P308+P313 | |||||||||
| Hazard Codes | Xi,N,T | |||||||||
| Risk Statements | 36/37/38-51/53-45-52/53-48/20/21/22-40 | |||||||||
| Safety Statements | 25-61-36/37/39 | |||||||||
| RIDADR | 1759 | |||||||||
| WGK Germany | 1 | |||||||||
| RTECS | RB9080000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 29172090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Aquatic Chronic 3 Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT RE 2 STOT SE 3 | |||||||||
| Hazardous Substances Data | 115-27-5(Hazardous Substances Data) | |||||||||
| NFPA 704: |
|
