4,4'-Diaminooctafluorobiphenyl
- Product Name4,4'-Diaminooctafluorobiphenyl
- CAS1038-66-0
- CBNumberCB3161252
- MFC12H4F8N2
- MW328.16
- EINECS213-861-4
- MDL NumberMFCD00007646
- MOL File1038-66-0.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 175-177 °C (lit.) |
| Boiling point | 279.4±35.0 °C(Predicted) |
| Density | 1.5568 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 0.02±0.21(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C12H4F8N2/c13-3-1(4(14)8(18)11(21)7(3)17)2-5(15)9(19)12(22)10(20)6(2)16/h21-22H2 |
| InChIKey | FWOLORXQTIGHFX-UHFFFAOYSA-N |
| SMILES | C1(C2=C(F)C(F)=C(N)C(F)=C2F)=C(F)C(F)=C(N)C(F)=C1F |
| CAS DataBase Reference | 1038-66-0(CAS DataBase Reference) |
| EPA Substance Registry System | [1,1'-Biphenyl]-4,4'-diamine, 2,2',3,3',5,5',6,6'-octafluoro- (1038-66-0) |
| UNSPSC Code | 12162002 |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | UN 3152 9/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| TSCA | TSCA listed |
| HazardClass | IRRITANT-HARMFUL |
| HS Code | 29215900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |