TRIS(TRIMETHYLSILOXY)SILANE
- Product NameTRIS(TRIMETHYLSILOXY)SILANE
- CAS1873-89-8
- CBNumberCB2487669
- MFC9H28O3Si4
- MW296.66
- EINECS217-497-7
- MDL NumberMFCD00054865
- MOL File1873-89-8.mol
Chemical Properties
| Melting point | <0°C |
| Boiling point | 185 °C (lit.) |
| Density | 0.852 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 131 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Benzene (Slightly), Chloroform (Sparingly) |
| form | clear liquid |
| Specific Gravity | 0.852 |
| color | Colorless to Almost colorless |
| Hydrolytic Sensitivity | 3: reacts with aqueous base |
| BRN | 1772735 |
| Stability | Hygroscopic, Moisture sensitive |
| InChI | 1S/C9H28O3Si4/c1-14(2,3)10-13(11-15(4,5)6)12-16(7,8)9/h13H,1-9H3 |
| InChIKey | FDWGGTLVZGTDGQ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O[SiH](O[Si](C)(C)C)O[Si](C)(C)C |
| UNSPSC Code | 12352103 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H226 | |||||||||
| Precautionary statements | P210-P240-P241-P280a-P303+P361+P353-P501a | |||||||||
| Risk Statements | 10 | |||||||||
| Safety Statements | 23-24/25 | |||||||||
| RIDADR | UN 1993 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| TSCA | No | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29310099 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Flam. Liq. 3 | |||||||||
| NFPA 704: |
|
