2,6-Di-tert-butyl-4-(dimethylaminomethyl)phenol
- Product Name2,6-Di-tert-butyl-4-(dimethylaminomethyl)phenol
- CAS88-27-7
- CBNumberCB2431950
- MFC17H29NO
- MW263.42
- EINECS201-816-1
- MDL NumberMFCD00026283
- MOL File88-27-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 93-94 °C(lit.) |
| Boiling point | 172 °C30 mm Hg(lit.) |
| Density | 0.9225 (rough estimate) |
| vapor pressure | 0.002Pa at 25℃ |
| refractive index | 1.5020 (estimate) |
| Flash point | 138°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 11.17±0.70(Predicted) |
| color | White to Yellow to Orange |
| Water Solubility | 10.7mg/L at 20℃ |
| BRN | 884076 |
| Henry's Law Constant | 4.8×103 mol/(m3Pa) at 25℃, Zhang et al. (2010) |
| InChI | 1S/C17H29NO/c1-16(2,3)13-9-12(11-18(7)8)10-14(15(13)19)17(4,5)6/h9-10,19H,11H2,1-8H3 |
| InChIKey | VMZVBRIIHDRYGK-UHFFFAOYSA-N |
| SMILES | CN(C)Cc1cc(c(O)c(c1)C(C)(C)C)C(C)(C)C |
| LogP | 4.24 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H319 | |||||||||
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22-36 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 2 | |||||||||
| RTECS | GO7887000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2922.29.8190 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 1 Eye Irrit. 2 Skin Sens. 1 | |||||||||
| NFPA 704: |
|
