2,3,4-Trifluorobenzenamine
- Product Name2,3,4-Trifluorobenzenamine
- CAS3862-73-5
- CBNumberCB2408622
- MFC6H4F3N
- MW147.1
- EINECS253-703-1
- MDL NumberMFCD00011737
- MOL File3862-73-5.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 14-15°C |
| Boiling point | 92 °C/48 mmHg (lit.) |
| Density | 1.393 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 155 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 2.25±0.10(Predicted) |
| form | A liquid |
| Specific Gravity | 1.393 |
| color | Colorless to Light yellow to Light orange |
| BRN | 3245609 |
| InChI | InChI=1S/C6H4F3N/c7-3-1-2-4(10)6(9)5(3)8/h1-2H,10H2 |
| InChIKey | WRDGNXCXTDDYBZ-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(F)C(F)=C1F |
| CAS DataBase Reference | 3862-73-5(CAS DataBase Reference) |
| EWG's Food Scores | 1-2 |
| EPA Substance Registry System | Benzenamine, 2,3,4-trifluoro-C198 (3862-73-5) |
| UNSPSC Code | 12352100 |
Safety
| Symbol(GHS) |
   
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302+H312-H315-H318-H373-H411 | |||||||||
| Precautionary statements | P273-P280-P301+P312-P302+P352+P312-P305+P351+P338-P314 | |||||||||
| Hazard Codes | Xn,N,Xi | |||||||||
| Risk Statements | 21/22-38-41-48/22-51/53 | |||||||||
| Safety Statements | 23-26-36/37/39-61 | |||||||||
| RIDADR | UN 3082 9/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | CY1211500 | |||||||||
| F | 9 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | 9 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29214210 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral Aquatic Chronic 2 Eye Dam. 1 Skin Irrit. 2 STOT RE 2 | |||||||||
| Toxicity | LD50 orl-rat: 699 mg/kg JACTDZ 1,61,90 | |||||||||
| NFPA 704: |
|
