1-Ethyl-3-methylimidazolium ethyl sulfate
- Product Name1-Ethyl-3-methylimidazolium ethyl sulfate
- CAS342573-75-5
- CBNumberCB2382832
- MFC8H16N2O4S
- MW236.29
- EINECS460-100-9
- MDL NumberMFCD06798189
- MOL File342573-75-5.mol
- MSDS FileSDS
Chemical Properties
| Melting point | <65°C |
| Density | 1.24 |
| vapor pressure | 7.1Pa at 20℃ |
| refractive index | n20/D 1.481 |
| Flash point | 162 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | liquid |
| color | colorless |
| Viscosity | 94.2 cP |
| Water Solubility | Miscible with water and alcohol. |
| InChI | InChI=1S/C6H11N2.C2H6O4S/c1-3-8-5-4-7(2)6-8;1-2-6-7(3,4)5/h4-6H,3H2,1-2H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | VRFOKYHDLYBVAL-UHFFFAOYSA-M |
| SMILES | S(OCC)(=O)(=O)[O-].[N+]1(C)C=CN(CC)C=1 |
| FDA UNII | 502J88S67B |
| EPA Substance Registry System | 1H-Imidazolium, 3-ethyl-1-methyl-, ethyl sulfate (1:1) (342573-75-5) |
| ECW | 4.0 V |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H315-H319-H340-H350 | |||||||||
| Precautionary statements | P202-P264-P280-P302+P352-P305+P351+P338-P308+P313 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 1 | |||||||||
| F | 3-10 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 29332900 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Carc. 1B Eye Irrit. 2 Muta. 1B Skin Irrit. 2 | |||||||||
| NFPA 704: |
|
