Domoic acid
- Product NameDomoic acid
- CAS14277-97-5
- CBNumberCB2359498
- MFC15H21NO6
- MW311.33
- MDL NumberMFCD06795841
- MOL File14277-97-5.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 213-217℃ |
| Boiling point | 451.38°C (rough estimate) |
| Density | 1.1800 (rough estimate) |
| refractive index | 1.5130 (estimate) |
| storage temp. | -20°C |
| solubility | methanol: 0.6 mg/mL |
| pka | 2.08±0.60(Predicted) |
| form | solid |
| color | white |
| optical activity | -109.612 (H2O) |
| Water Solubility | Soluble in water at 8mg/ml. Soluble in methanol at 0.6mg/ml. |
| Merck | 13,3451 |
| BRN | 46376 |
| Stability | Light Sensitive |
| InChIKey | VZFRNCSOCOPNDB-AOKDLOFSSA-N |
| SMILES | OC([C@H](C)/C=C/C=C([C@@H]1[C@H](CC(O)=O)[C@@H](C(O)=O)NC1)/C)=O |
| FDA UNII | M02525818H |
| EPA Substance Registry System | Domoic acid (14277-97-5) |
Safety
| Symbol(GHS) |
![]()
|
| Signal word | Danger |
| Hazard statements | H302-H370 |
| Precautionary statements | P260-P264-P270-P301+P312-P308+P311-P405 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| RTECS | UX9665100 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral STOT SE 1 |
| Hazardous Substances Data | 14277-97-5(Hazardous Substances Data) |
| Toxicity | An excitory amino acid isolated from the red alga Chondria armata. A structural analog of kainic acid and domoic acid has been shown to be responsible for the shellfish poisoning associated with eating certain cultured blue mussels. |
