N-Boc-hexahydro-1H-azepin-4-one
- Product NameN-Boc-hexahydro-1H-azepin-4-one
- CAS188975-88-4
- CBNumberCB2294582
- MFC11H19NO3
- MW213.27
- MDL NumberMFCD03788435
- MOL File188975-88-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 145 °C |
| Boiling point | 90-1000C/0.5mmHg |
| Density | 1.072±0.06 g/cm3(Predicted) |
| refractive index | n20/D 1.467 |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform, Dichloromethane, Ethanol and Ethyl Ether. |
| pka | -1.50±0.20(Predicted) |
| form | Liquid or Low Melting Solid |
| color | Colorless to yellow |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C11H19NO3/c1-11(2,3)15-10(14)12-7-4-5-9(13)6-8-12/h4-8H2,1-3H3 |
| InChIKey | PMLBUVZPRKXMOX-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCCC(=O)CC1 |
| CAS DataBase Reference | 188975-88-4(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H315-H319-H335 | |||||||||
| Precautionary statements | P301+P312+P330-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi,Xn | |||||||||
| Risk Statements | 36/37/38-22 | |||||||||
| Safety Statements | 26-36/37/39 | |||||||||
| WGK Germany | WGK 3 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29242990 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|