(3S,4S)-1-Benzylpyrrolidine-3,4-diol
- Product Name(3S,4S)-1-Benzylpyrrolidine-3,4-diol
- CAS90365-74-5
- CBNumberCB2187071
- MFC11H15NO2
- MW193.24
- MDL NumberMFCD01073893
- MOL File90365-74-5.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 94-100 °C |
| alpha | 33.6 º (c=1.05% in methanol) |
| Boiling point | 329.46°C (rough estimate) |
| Density | 1.0945 (rough estimate) |
| refractive index | 1.5041 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 13.99±0.40(Predicted) |
| form | Powder, Crystals, and/or Chunks |
| color | Off-white to yellow to light brown |
| optical activity | [α]20/D +33.6±3°, c = 1.05% in methanol |
| BRN | 4992458 |
| InChI | InChI=1S/C11H15NO2/c13-10-7-12(8-11(10)14)6-9-4-2-1-3-5-9/h1-5,10-11,13-14H,6-8H2/t10-,11-/m0/s1 |
| InChIKey | QJRIUWQPJVPYSO-QWRGUYRKSA-N |
| SMILES | N1(CC2=CC=CC=C2)C[C@H](O)[C@@H](O)C1 |
| CAS DataBase Reference | 90365-74-5(CAS DataBase Reference) |
| UNSPSC Code | 12352005 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| F | 10-34 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |