Ethyl ziram
- Product NameEthyl ziram
- CAS14324-55-1
- CBNumberCB2176910
- MFC10H20N2S4Zn
- MW361.93
- EINECS238-270-9
- MDL NumberMFCD00064798
- MOL File14324-55-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 178-181 °C (lit.) |
| Boiling point | 330.6°C (estimate) |
| Density | 1,48 g/cm3 |
| vapor pressure | 0.007Pa at 25℃ |
| Flash point | 204°(400°F) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Sparingly), Methanol (Slightly, Heated, Sonicated) |
| form | solid |
| Specific Gravity | 1.48 |
| color | White |
| Water Solubility | Insoluble in water. Soluble in benzene carbon disulfide and organic liquids. |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | 1S/2C5H11NS2.Zn/c2*1-3-6(4-2)5(7)8;/h2*3-4H2,1-2H3,(H,7,8);/q;;+2/p-2 |
| InChIKey | RKQOSDAEEGPRER-UHFFFAOYSA-L |
| SMILES | CCN(CC)C(=S)S[Zn]SC(=S)N(CC)CC |
| LogP | 3.11 |
| CAS DataBase Reference | 14324-55-1(CAS DataBase Reference) |
| Indirect Additives used in Food Contact Substances | ZINC DIETHYLDITHIOCARBAMATE |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H315-H317-H319-H335-H373-H410 | |||||||||
| Precautionary statements | P273-P280-P301+P312-P302+P352-P305+P351+P338-P314 | |||||||||
| Hazard Codes | Xn,N | |||||||||
| Risk Statements | 22-36/37/38-43-50/53 | |||||||||
| Safety Statements | 24-37-60-61 | |||||||||
| RIDADR | UN 3077 9/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | ZH0350000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29302000 | |||||||||
| Storage Class | 13 - Non Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT RE 2 Oral STOT SE 3 | |||||||||
| Hazardous Substances Data | 14324-55-1(Hazardous Substances Data) | |||||||||
| Toxicity | LD50 orl-rat: 3340 mg/kg 28ZPAK -,11,72 | |||||||||
| NFPA 704: |
|
