(R)-(-)-O-Formylmandeloyl chloride
- Product Name(R)-(-)-O-Formylmandeloyl chloride
- CAS29169-64-0
- CBNumberCB2176622
- MFC9H7ClO3
- MW198.6
- EINECS249-478-4
- MDL NumberMFCD00799229
- MOL File29169-64-0.mol
- MSDS FileSDS
Chemical Properties
| Boiling point | 221 °C(lit.) |
| Density | 1.290 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| optical activity | [α]23/D 228°, neat |
| BRN | 5404068 |
| InChI | 1S/C9H7ClO3/c10-9(12)8(13-6-11)7-4-2-1-3-5-7/h1-6,8H/t8-/m1/s1 |
| InChIKey | YASBRFHEBZXBJW-SSDOTTSWSA-N |
| SMILES | ClC(=O)[C@H](OC=O)c1ccccc1 |
| CAS DataBase Reference | 29169-64-0(CAS DataBase Reference) |
| EPA Substance Registry System | Benzeneacetyl chloride, .alpha.-(formyloxy)-, (.alpha.R)- (29169-64-0) |
| UNSPSC Code | 12352101 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 3265 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29181990 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B | |||||||||
| NFPA 704: |
|
